C22H25N3O4 — CID 86910638
N-(1-acetylpiperidin-4-yl)-2-[(2-methoxydibenzofuran-3-yl)amino]acetamide (PubChem CID 86910638) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is N-(1-acetylpiperidin-4-yl)-2-[(2-methoxydibenzofuran-3-yl)amino]acetamide.
| Compound Name | N-(1-acetylpiperidin-4-yl)-2-[(2-methoxydibenzofuran-3-yl)amino]acetamide |
|---|---|
| PubChem CID | 86910638 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | N-(1-acetylpiperidin-4-yl)-2-[(2-methoxydibenzofuran-3-yl)amino]acetamide |
| SMILES | COc1cc2c(cc1NCC(=O)NC1CCN(C(C)=O)CC1)oc1ccccc12 |
| InChI | InChI=1S/C22H25N3O4/c1-14(26)25-9-7-15(8-10-25)24-22(27)13-23-18-12-20-17(11-21(18)28-2)16-5-3-4-6-19(16)29-20/h3-6,11-12,15,23H,7-10,13H2,1-2H3,(H,24,27) |
| InChIKey | PQACVRLYJMGETK-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_OC_alk_A(4)', 'substructure': 'N/A'} |
|---|