C25H30N2O5 — CID 52775307
tert-butyl 4-[2-[(2-methoxydibenzofuran-3-yl)amino]-2-oxoethyl]piperidine-1-carboxylate (PubChem CID 52775307) has the molecular formula C25H30N2O5 and a molecular weight of 438.52 g/mol. Its IUPAC name is tert-butyl 4-[2-[(2-methoxydibenzofuran-3-yl)amino]-2-oxoethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[(2-methoxydibenzofuran-3-yl)amino]-2-oxoethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 52775307 |
| Molecular Formula | C25H30N2O5 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | tert-butyl 4-[2-[(2-methoxydibenzofuran-3-yl)amino]-2-oxoethyl]piperidine-1-carboxylate |
| SMILES | COc1cc2c(cc1NC(=O)CC1CCN(C(=O)OC(C)(C)C)CC1)oc1ccccc12 |
| InChI | InChI=1S/C25H30N2O5/c1-25(2,3)32-24(29)27-11-9-16(10-12-27)13-23(28)26-19-15-21-18(14-22(19)30-4)17-7-5-6-8-20(17)31-21/h5-8,14-16H,9-13H2,1-4H3,(H,26,28) |
| InChIKey | IXBXAOKWZDVQDQ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |