C17H14ClF2NO5S — CID 2499544
[2-(5-chloro-2-methylanilino)-2-oxoethyl] 4-(difluoromethylsulfonyl)benzoate (PubChem CID 2499544) has the molecular formula C17H14ClF2NO5S and a molecular weight of 417.82 g/mol. Its IUPAC name is [2-(5-chloro-2-methylanilino)-2-oxoethyl] 4-(difluoromethylsulfonyl)benzoate.
| Compound Name | [2-(5-chloro-2-methylanilino)-2-oxoethyl] 4-(difluoromethylsulfonyl)benzoate |
|---|---|
| PubChem CID | 2499544 |
| Molecular Formula | C17H14ClF2NO5S |
| Molecular Weight | 417.82 g/mol |
| Exact Mass | 417.02 |
| IUPAC Name | [2-(5-chloro-2-methylanilino)-2-oxoethyl] 4-(difluoromethylsulfonyl)benzoate |
| SMILES | Cc1ccc(Cl)cc1NC(=O)COC(=O)c1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C17H14ClF2NO5S/c1-10-2-5-12(18)8-14(10)21-15(22)9-26-16(23)11-3-6-13(7-4-11)27(24,25)17(19)20/h2-8,17H,9H2,1H3,(H,21,22) |
| InChIKey | YTJHDWRMRWMPEX-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.82 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |