C9H9FN4O4S2 — CID 102693893
N-(3-fluoro-5-sulfamoylphenyl)-1H-pyrazole-5-sulfonamide (PubChem CID 102693893) has the molecular formula C9H9FN4O4S2 and a molecular weight of 320.33 g/mol. Its IUPAC name is N-(3-fluoro-5-sulfamoylphenyl)-1H-pyrazole-5-sulfonamide.
| Compound Name | N-(3-fluoro-5-sulfamoylphenyl)-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 102693893 |
| Molecular Formula | C9H9FN4O4S2 |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | N-(3-fluoro-5-sulfamoylphenyl)-1H-pyrazole-5-sulfonamide |
| SMILES | NS(=O)(=O)c1cc(F)cc(NS(=O)(=O)c2ccn[nH]2)c1 |
| InChI | InChI=1S/C9H9FN4O4S2/c10-6-3-7(5-8(4-6)19(11,15)16)14-20(17,18)9-1-2-12-13-9/h1-5,14H,(H,12,13)(H2,11,15,16) |
| InChIKey | URVCHVTXLHZINI-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 135.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |