C11H14N4O4S2 — CID 102691736
N-[3-(dimethylsulfamoyl)phenyl]-1H-pyrazole-5-sulfonamide (PubChem CID 102691736) has the molecular formula C11H14N4O4S2 and a molecular weight of 330.39 g/mol. Its IUPAC name is N-[3-(dimethylsulfamoyl)phenyl]-1H-pyrazole-5-sulfonamide.
| Compound Name | N-[3-(dimethylsulfamoyl)phenyl]-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 102691736 |
| Molecular Formula | C11H14N4O4S2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | N-[3-(dimethylsulfamoyl)phenyl]-1H-pyrazole-5-sulfonamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(NS(=O)(=O)c2ccn[nH]2)c1 |
| InChI | InChI=1S/C11H14N4O4S2/c1-15(2)21(18,19)10-5-3-4-9(8-10)14-20(16,17)11-6-7-12-13-11/h3-8,14H,1-2H3,(H,12,13) |
| InChIKey | KKXLWRNNAPLMJW-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 112.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |