C13H23N3O5S2 — CID 120583580
N-(4-aminobutyl)-4-(ethylsulfonylamino)-2-methoxybenzenesulfonamide (PubChem CID 120583580) has the molecular formula C13H23N3O5S2 and a molecular weight of 365.48 g/mol. Its IUPAC name is N-(4-aminobutyl)-4-(ethylsulfonylamino)-2-methoxybenzenesulfonamide.
| Compound Name | N-(4-aminobutyl)-4-(ethylsulfonylamino)-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 120583580 |
| Molecular Formula | C13H23N3O5S2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | N-(4-aminobutyl)-4-(ethylsulfonylamino)-2-methoxybenzenesulfonamide |
| SMILES | CCS(=O)(=O)Nc1ccc(S(=O)(=O)NCCCCN)c(OC)c1 |
| InChI | InChI=1S/C13H23N3O5S2/c1-3-22(17,18)16-11-6-7-13(12(10-11)21-2)23(19,20)15-9-5-4-8-14/h6-7,10,15-16H,3-5,8-9,14H2,1-2H3 |
| InChIKey | ZJFVYTPDOWHLLL-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|