C13H23N3O5S2 — CID 120825303
4-(ethylsulfonylamino)-2-methoxy-N-[2-(methylamino)propyl]benzenesulfonamide (PubChem CID 120825303) has the molecular formula C13H23N3O5S2 and a molecular weight of 365.48 g/mol. Its IUPAC name is 4-(ethylsulfonylamino)-2-methoxy-N-[2-(methylamino)propyl]benzenesulfonamide.
| Compound Name | 4-(ethylsulfonylamino)-2-methoxy-N-[2-(methylamino)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 120825303 |
| Molecular Formula | C13H23N3O5S2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 4-(ethylsulfonylamino)-2-methoxy-N-[2-(methylamino)propyl]benzenesulfonamide |
| SMILES | CCS(=O)(=O)Nc1ccc(S(=O)(=O)NCC(C)NC)c(OC)c1 |
| InChI | InChI=1S/C13H23N3O5S2/c1-5-22(17,18)16-11-6-7-13(12(8-11)21-4)23(19,20)15-9-10(2)14-3/h6-8,10,14-16H,5,9H2,1-4H3 |
| InChIKey | UMYPKYFENBWSHS-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |