C14H11Cl2N3O3S — CID 2242342
2,5-dichloro-N-(1H-indazol-6-yl)-4-methoxybenzenesulfonamide (PubChem CID 2242342) has the molecular formula C14H11Cl2N3O3S and a molecular weight of 372.23 g/mol. Its IUPAC name is 2,5-dichloro-N-(1H-indazol-6-yl)-4-methoxybenzenesulfonamide.
| Compound Name | 2,5-dichloro-N-(1H-indazol-6-yl)-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 2242342 |
| Molecular Formula | C14H11Cl2N3O3S |
| Molecular Weight | 372.23 g/mol |
| Exact Mass | 370.99 |
| IUPAC Name | 2,5-dichloro-N-(1H-indazol-6-yl)-4-methoxybenzenesulfonamide |
| SMILES | COc1cc(Cl)c(S(=O)(=O)Nc2ccc3cn[nH]c3c2)cc1Cl |
| InChI | InChI=1S/C14H11Cl2N3O3S/c1-22-13-5-11(16)14(6-10(13)15)23(20,21)19-9-3-2-8-7-17-18-12(8)4-9/h2-7,19H,1H3,(H,17,18) |
| InChIKey | OSBNPTIYJHQZFK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.23 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |