C14H9ClN3O4S- — CID 7041976
4-chloro-3-(1H-indazol-6-ylsulfamoyl)benzoate (PubChem CID 7041976) has the molecular formula C14H9ClN3O4S- and a molecular weight of 350.76 g/mol. Its IUPAC name is 4-chloro-3-(1H-indazol-6-ylsulfamoyl)benzoate.
| Compound Name | 4-chloro-3-(1H-indazol-6-ylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 7041976 |
| Molecular Formula | C14H9ClN3O4S- |
| Molecular Weight | 350.76 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | 4-chloro-3-(1H-indazol-6-ylsulfamoyl)benzoate |
| SMILES | O=C([O-])c1ccc(Cl)c(S(=O)(=O)Nc2ccc3cn[nH]c3c2)c1 |
| InChI | InChI=1S/C14H10ClN3O4S/c15-11-4-2-8(14(19)20)5-13(11)23(21,22)18-10-3-1-9-7-16-17-12(9)6-10/h1-7,18H,(H,16,17)(H,19,20)/p-1 |
| InChIKey | AUWYHLQCORSBCN-UHFFFAOYSA-M |
| XLogP | 1.38 |
| TPSA | 114.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.76 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |