C19H17ClN2O4S3 — CID 23096482
N-(5-chloro-2-methoxyphenyl)-2-[4-(thiophen-2-ylsulfonylamino)phenyl]sulfanylacetamide (PubChem CID 23096482) has the molecular formula C19H17ClN2O4S3 and a molecular weight of 469.01 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-2-[4-(thiophen-2-ylsulfonylamino)phenyl]sulfanylacetamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-2-[4-(thiophen-2-ylsulfonylamino)phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 23096482 |
| Molecular Formula | C19H17ClN2O4S3 |
| Molecular Weight | 469.01 g/mol |
| Exact Mass | 468.00 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-2-[4-(thiophen-2-ylsulfonylamino)phenyl]sulfanylacetamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)CSc1ccc(NS(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C19H17ClN2O4S3/c1-26-17-9-4-13(20)11-16(17)21-18(23)12-28-15-7-5-14(6-8-15)22-29(24,25)19-3-2-10-27-19/h2-11,22H,12H2,1H3,(H,21,23) |
| InChIKey | AJIIIRJLQXWBBV-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.01 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |