C11H12N2O4S2 — CID 26980778
2,5-dimethyl-N'-thiophen-2-ylsulfonylfuran-3-carbohydrazide (PubChem CID 26980778) has the molecular formula C11H12N2O4S2 and a molecular weight of 300.36 g/mol. Its IUPAC name is 2,5-dimethyl-N'-thiophen-2-ylsulfonylfuran-3-carbohydrazide.
| Compound Name | 2,5-dimethyl-N'-thiophen-2-ylsulfonylfuran-3-carbohydrazide |
|---|---|
| PubChem CID | 26980778 |
| Molecular Formula | C11H12N2O4S2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | 2,5-dimethyl-N'-thiophen-2-ylsulfonylfuran-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNS(=O)(=O)c2cccs2)c(C)o1 |
| InChI | InChI=1S/C11H12N2O4S2/c1-7-6-9(8(2)17-7)11(14)12-13-19(15,16)10-4-3-5-18-10/h3-6,13H,1-2H3,(H,12,14) |
| InChIKey | KQABKBRASUQYMN-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|