C22H17ClN4O3S — CID 2965443
6-chloro-N-[4-(methylsulfamoyl)phenyl]-2-pyridin-3-ylquinoline-4-carboxamide (PubChem CID 2965443) has the molecular formula C22H17ClN4O3S and a molecular weight of 452.92 g/mol. Its IUPAC name is 6-chloro-N-[4-(methylsulfamoyl)phenyl]-2-pyridin-3-ylquinoline-4-carboxamide.
| Compound Name | 6-chloro-N-[4-(methylsulfamoyl)phenyl]-2-pyridin-3-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 2965443 |
| Molecular Formula | C22H17ClN4O3S |
| Molecular Weight | 452.92 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | 6-chloro-N-[4-(methylsulfamoyl)phenyl]-2-pyridin-3-ylquinoline-4-carboxamide |
| SMILES | CNS(=O)(=O)c1ccc(NC(=O)c2cc(-c3cccnc3)nc3ccc(Cl)cc23)cc1 |
| InChI | InChI=1S/C22H17ClN4O3S/c1-24-31(29,30)17-7-5-16(6-8-17)26-22(28)19-12-21(14-3-2-10-25-13-14)27-20-9-4-15(23)11-18(19)20/h2-13,24H,1H3,(H,26,28) |
| InChIKey | XTHGMMDXECMVMX-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.92 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |