C18H16N2O4S2 — CID 3509609
6-pyrrolidin-1-ylsulfonyl-2-thiophen-2-ylquinoline-4-carboxylic acid (PubChem CID 3509609) has the molecular formula C18H16N2O4S2 and a molecular weight of 388.47 g/mol. Its IUPAC name is 6-pyrrolidin-1-ylsulfonyl-2-thiophen-2-ylquinoline-4-carboxylic acid.
| Compound Name | 6-pyrrolidin-1-ylsulfonyl-2-thiophen-2-ylquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 3509609 |
| Molecular Formula | C18H16N2O4S2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 6-pyrrolidin-1-ylsulfonyl-2-thiophen-2-ylquinoline-4-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2cccs2)nc2ccc(S(=O)(=O)N3CCCC3)cc12 |
| InChI | InChI=1S/C18H16N2O4S2/c21-18(22)14-11-16(17-4-3-9-25-17)19-15-6-5-12(10-13(14)15)26(23,24)20-7-1-2-8-20/h3-6,9-11H,1-2,7-8H2,(H,21,22) |
| InChIKey | STCDLKGFRXXNKI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |