C20H17ClN2O5S — CID 3618004
2-(3-chlorophenyl)-6-morpholin-4-ylsulfonylquinoline-4-carboxylic acid (PubChem CID 3618004) has the molecular formula C20H17ClN2O5S and a molecular weight of 432.89 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-6-morpholin-4-ylsulfonylquinoline-4-carboxylic acid.
| Compound Name | 2-(3-chlorophenyl)-6-morpholin-4-ylsulfonylquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 3618004 |
| Molecular Formula | C20H17ClN2O5S |
| Molecular Weight | 432.89 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | 2-(3-chlorophenyl)-6-morpholin-4-ylsulfonylquinoline-4-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2cccc(Cl)c2)nc2ccc(S(=O)(=O)N3CCOCC3)cc12 |
| InChI | InChI=1S/C20H17ClN2O5S/c21-14-3-1-2-13(10-14)19-12-17(20(24)25)16-11-15(4-5-18(16)22-19)29(26,27)23-6-8-28-9-7-23/h1-5,10-12H,6-9H2,(H,24,25) |
| InChIKey | VAPNFGKEEIITFE-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.89 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |