C25H28N4O4S — CID 3580966
azepan-1-yl-(6-morpholin-4-ylsulfonyl-2-pyridin-2-ylquinolin-4-yl)methanone (PubChem CID 3580966) has the molecular formula C25H28N4O4S and a molecular weight of 480.59 g/mol. Its IUPAC name is azepan-1-yl-(6-morpholin-4-ylsulfonyl-2-pyridin-2-ylquinolin-4-yl)methanone.
| Compound Name | azepan-1-yl-(6-morpholin-4-ylsulfonyl-2-pyridin-2-ylquinolin-4-yl)methanone |
|---|---|
| PubChem CID | 3580966 |
| Molecular Formula | C25H28N4O4S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | azepan-1-yl-(6-morpholin-4-ylsulfonyl-2-pyridin-2-ylquinolin-4-yl)methanone |
| SMILES | O=C(c1cc(-c2ccccn2)nc2ccc(S(=O)(=O)N3CCOCC3)cc12)N1CCCCCC1 |
| InChI | InChI=1S/C25H28N4O4S/c30-25(28-11-5-1-2-6-12-28)21-18-24(23-7-3-4-10-26-23)27-22-9-8-19(17-20(21)22)34(31,32)29-13-15-33-16-14-29/h3-4,7-10,17-18H,1-2,5-6,11-16H2 |
| InChIKey | LHLDCAUNFPFGLZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 92.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |