C19H18N2O3S2 — CID 1247057
N-(4-pyrrolidin-1-ylsulfonylphenyl)-1-benzothiophene-3-carboxamide (PubChem CID 1247057) has the molecular formula C19H18N2O3S2 and a molecular weight of 386.50 g/mol. Its IUPAC name is N-(4-pyrrolidin-1-ylsulfonylphenyl)-1-benzothiophene-3-carboxamide.
| Compound Name | N-(4-pyrrolidin-1-ylsulfonylphenyl)-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 1247057 |
| Molecular Formula | C19H18N2O3S2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | N-(4-pyrrolidin-1-ylsulfonylphenyl)-1-benzothiophene-3-carboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)N2CCCC2)cc1)c1csc2ccccc12 |
| InChI | InChI=1S/C19H18N2O3S2/c22-19(17-13-25-18-6-2-1-5-16(17)18)20-14-7-9-15(10-8-14)26(23,24)21-11-3-4-12-21/h1-2,5-10,13H,3-4,11-12H2,(H,20,22) |
| InChIKey | JYJACGMPPGGIEE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |