C17H17N3O5S — CID 5181244
2-nitro-N-(4-pyrrolidin-1-ylsulfonylphenyl)benzamide (PubChem CID 5181244) has the molecular formula C17H17N3O5S and a molecular weight of 375.41 g/mol. Its IUPAC name is 2-nitro-N-(4-pyrrolidin-1-ylsulfonylphenyl)benzamide.
| Compound Name | 2-nitro-N-(4-pyrrolidin-1-ylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 5181244 |
| Molecular Formula | C17H17N3O5S |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 2-nitro-N-(4-pyrrolidin-1-ylsulfonylphenyl)benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)N2CCCC2)cc1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H17N3O5S/c21-17(15-5-1-2-6-16(15)20(22)23)18-13-7-9-14(10-8-13)26(24,25)19-11-3-4-12-19/h1-2,5-10H,3-4,11-12H2,(H,18,21) |
| InChIKey | PXYQAIRTDXNCJY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|