C20H22N4O2S — CID 131909926
1-methyl-N-[2-(morpholin-4-ylmethyl)phenyl]-3-thiophen-2-ylpyrazole-5-carboxamide (PubChem CID 131909926) has the molecular formula C20H22N4O2S and a molecular weight of 382.49 g/mol. Its IUPAC name is 1-methyl-N-[2-(morpholin-4-ylmethyl)phenyl]-3-thiophen-2-ylpyrazole-5-carboxamide.
| Compound Name | 1-methyl-N-[2-(morpholin-4-ylmethyl)phenyl]-3-thiophen-2-ylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 131909926 |
| Molecular Formula | C20H22N4O2S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 1-methyl-N-[2-(morpholin-4-ylmethyl)phenyl]-3-thiophen-2-ylpyrazole-5-carboxamide |
| SMILES | Cn1nc(-c2cccs2)cc1C(=O)Nc1ccccc1CN1CCOCC1 |
| InChI | InChI=1S/C20H22N4O2S/c1-23-18(13-17(22-23)19-7-4-12-27-19)20(25)21-16-6-3-2-5-15(16)14-24-8-10-26-11-9-24/h2-7,12-13H,8-11,14H2,1H3,(H,21,25) |
| InChIKey | KRDPGXOZSDCTBO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |