C21H21N7O — CID 122293049
N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]quinoline-2-carboxamide (PubChem CID 122293049) has the molecular formula C21H21N7O and a molecular weight of 387.45 g/mol. Its IUPAC name is N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]quinoline-2-carboxamide.
| Compound Name | N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 122293049 |
| Molecular Formula | C21H21N7O |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]quinoline-2-carboxamide |
| SMILES | Cc1cc(C)n(-c2ccc(NCCNC(=O)c3ccc4ccccc4n3)nn2)n1 |
| InChI | InChI=1S/C21H21N7O/c1-14-13-15(2)28(27-14)20-10-9-19(25-26-20)22-11-12-23-21(29)18-8-7-16-5-3-4-6-17(16)24-18/h3-10,13H,11-12H2,1-2H3,(H,22,25)(H,23,29) |
| InChIKey | UJZZBKLTJIAWJL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|