C16H22N6O2 — CID 122293459
N-[2-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]ethyl]-2-methoxypyridine-4-carboxamide (PubChem CID 122293459) has the molecular formula C16H22N6O2 and a molecular weight of 330.39 g/mol. Its IUPAC name is N-[2-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]ethyl]-2-methoxypyridine-4-carboxamide.
| Compound Name | N-[2-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]ethyl]-2-methoxypyridine-4-carboxamide |
|---|---|
| PubChem CID | 122293459 |
| Molecular Formula | C16H22N6O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | N-[2-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]ethyl]-2-methoxypyridine-4-carboxamide |
| SMILES | CCNc1cc(NCCNC(=O)c2ccnc(OC)c2)nc(C)n1 |
| InChI | InChI=1S/C16H22N6O2/c1-4-17-13-10-14(22-11(2)21-13)18-7-8-20-16(23)12-5-6-19-15(9-12)24-3/h5-6,9-10H,4,7-8H2,1-3H3,(H,20,23)(H2,17,18,21,22) |
| InChIKey | RGIALSFLKUUBAF-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 101.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|