C15H19FN6O — CID 122293470
N-[2-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]ethyl]-5-fluoropyridine-3-carboxamide (PubChem CID 122293470) has the molecular formula C15H19FN6O and a molecular weight of 318.36 g/mol. Its IUPAC name is N-[2-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]ethyl]-5-fluoropyridine-3-carboxamide.
| Compound Name | N-[2-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]ethyl]-5-fluoropyridine-3-carboxamide |
|---|---|
| PubChem CID | 122293470 |
| Molecular Formula | C15H19FN6O |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | N-[2-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]ethyl]-5-fluoropyridine-3-carboxamide |
| SMILES | CCNc1cc(NCCNC(=O)c2cncc(F)c2)nc(C)n1 |
| InChI | InChI=1S/C15H19FN6O/c1-3-18-13-7-14(22-10(2)21-13)19-4-5-20-15(23)11-6-12(16)9-17-8-11/h6-9H,3-5H2,1-2H3,(H,20,23)(H2,18,19,21,22) |
| InChIKey | HPYYFIZBBAFDEB-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|