C13H22ClN3O3 — CID 119408225
N-(3-aminopropyl)-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetamide;hydrochloride (PubChem CID 119408225) has the molecular formula C13H22ClN3O3 and a molecular weight of 303.79 g/mol. Its IUPAC name is N-(3-aminopropyl)-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetamide;hydrochloride.
| Compound Name | N-(3-aminopropyl)-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119408225 |
| Molecular Formula | C13H22ClN3O3 |
| Molecular Weight | 303.79 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | N-(3-aminopropyl)-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetamide;hydrochloride |
| SMILES | Cl.NCCCNC(=O)CN1C(=O)C2CCCCC2C1=O |
| InChI | InChI=1S/C13H21N3O3.ClH/c14-6-3-7-15-11(17)8-16-12(18)9-4-1-2-5-10(9)13(16)19;/h9-10H,1-8,14H2,(H,15,17);1H |
| InChIKey | YGBVVICGLYMZCC-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.79 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|