C13H21N3O3 — CID 120505467
N-[(2S)-1-aminopropan-2-yl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetamide (PubChem CID 120505467) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is N-[(2S)-1-aminopropan-2-yl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetamide.
| Compound Name | N-[(2S)-1-aminopropan-2-yl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 120505467 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | N-[(2S)-1-aminopropan-2-yl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetamide |
| SMILES | C[C@@H](CN)NC(=O)CN1C(=O)C2CCCCC2C1=O |
| InChI | InChI=1S/C13H21N3O3/c1-8(6-14)15-11(17)7-16-12(18)9-4-2-3-5-10(9)13(16)19/h8-10H,2-7,14H2,1H3,(H,15,17)/t8-,9?,10?/m0/s1 |
| InChIKey | CZWPWEQYQQGGNM-IDKOKCKLSA-N |
| XLogP | -0.38 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|