C19H23BrN2O3 — CID 55716886
N-[1-(4-bromophenyl)propan-2-yl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetamide (PubChem CID 55716886) has the molecular formula C19H23BrN2O3 and a molecular weight of 407.31 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)propan-2-yl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetamide.
| Compound Name | N-[1-(4-bromophenyl)propan-2-yl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 55716886 |
| Molecular Formula | C19H23BrN2O3 |
| Molecular Weight | 407.31 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | N-[1-(4-bromophenyl)propan-2-yl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetamide |
| SMILES | CC(Cc1ccc(Br)cc1)NC(=O)CN1C(=O)C2CCCCC2C1=O |
| InChI | InChI=1S/C19H23BrN2O3/c1-12(10-13-6-8-14(20)9-7-13)21-17(23)11-22-18(24)15-4-2-3-5-16(15)19(22)25/h6-9,12,15-16H,2-5,10-11H2,1H3,(H,21,23) |
| InChIKey | WXBDQKMMKYAYNI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.31 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|