C20H25FN2O3 — CID 46828413
2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[1-(4-fluorophenyl)-2-methylpropyl]acetamide (PubChem CID 46828413) has the molecular formula C20H25FN2O3 and a molecular weight of 360.43 g/mol. Its IUPAC name is 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[1-(4-fluorophenyl)-2-methylpropyl]acetamide.
| Compound Name | 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[1-(4-fluorophenyl)-2-methylpropyl]acetamide |
|---|---|
| PubChem CID | 46828413 |
| Molecular Formula | C20H25FN2O3 |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[1-(4-fluorophenyl)-2-methylpropyl]acetamide |
| SMILES | CC(C)C(NC(=O)CN1C(=O)C2CCCCC2C1=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H25FN2O3/c1-12(2)18(13-7-9-14(21)10-8-13)22-17(24)11-23-19(25)15-5-3-4-6-16(15)20(23)26/h7-10,12,15-16,18H,3-6,11H2,1-2H3,(H,22,24) |
| InChIKey | JHRNHCZYNALGHT-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|