C15H22N2O5 — CID 119368157
(2R)-2-[[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetyl]amino]-3-methylbutanoic acid (PubChem CID 119368157) has the molecular formula C15H22N2O5 and a molecular weight of 310.35 g/mol. Its IUPAC name is (2R)-2-[[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetyl]amino]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 119368157 |
| Molecular Formula | C15H22N2O5 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | (2R)-2-[[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@@H](NC(=O)CN1C(=O)C2CCCCC2C1=O)C(=O)O |
| InChI | InChI=1S/C15H22N2O5/c1-8(2)12(15(21)22)16-11(18)7-17-13(19)9-5-3-4-6-10(9)14(17)20/h8-10,12H,3-7H2,1-2H3,(H,16,18)(H,21,22)/t9?,10?,12-/m1/s1 |
| InChIKey | JLHOFVJVJJFAJE-RTYFJBAXSA-N |
| XLogP | 0.39 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|