C26H30N2O3 — CID 112791234
2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-(3,3-diphenylpropyl)propanamide (PubChem CID 112791234) has the molecular formula C26H30N2O3 and a molecular weight of 418.54 g/mol. Its IUPAC name is 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-(3,3-diphenylpropyl)propanamide.
| Compound Name | 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-(3,3-diphenylpropyl)propanamide |
|---|---|
| PubChem CID | 112791234 |
| Molecular Formula | C26H30N2O3 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-(3,3-diphenylpropyl)propanamide |
| SMILES | CC(C(=O)NCCC(c1ccccc1)c1ccccc1)N1C(=O)C2CCCCC2C1=O |
| InChI | InChI=1S/C26H30N2O3/c1-18(28-25(30)22-14-8-9-15-23(22)26(28)31)24(29)27-17-16-21(19-10-4-2-5-11-19)20-12-6-3-7-13-20/h2-7,10-13,18,21-23H,8-9,14-17H2,1H3,(H,27,29) |
| InChIKey | UVBKDUVLTWQTIM-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|