C23H30ClN3O2 — CID 11429950
2-(4,4-dimethyl-2-oxopiperazin-4-ium-1-yl)-N-(3,3-diphenylpropyl)acetamide chloride (PubChem CID 11429950) has the molecular formula C23H30ClN3O2 and a molecular weight of 415.97 g/mol. Its IUPAC name is 2-(4,4-dimethyl-2-oxopiperazin-4-ium-1-yl)-N-(3,3-diphenylpropyl)acetamide chloride.
| Compound Name | 2-(4,4-dimethyl-2-oxopiperazin-4-ium-1-yl)-N-(3,3-diphenylpropyl)acetamide chloride |
|---|---|
| PubChem CID | 11429950 |
| Molecular Formula | C23H30ClN3O2 |
| Molecular Weight | 415.97 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 2-(4,4-dimethyl-2-oxopiperazin-4-ium-1-yl)-N-(3,3-diphenylpropyl)acetamide chloride |
| SMILES | C[N+]1(C)CCN(CC(=O)NCCC(c2ccccc2)c2ccccc2)C(=O)C1.[Cl-] |
| InChI | InChI=1S/C23H29N3O2.ClH/c1-26(2)16-15-25(23(28)18-26)17-22(27)24-14-13-21(19-9-5-3-6-10-19)20-11-7-4-8-12-20;/h3-12,21H,13-18H2,1-2H3;1H |
| InChIKey | RFNBLCLXJZMXNT-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.97 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|