C18H28N3O2S+ — CID 11395046
N-(2-benzylsulfanylethyl)-2-(4,4-dimethyl-2-oxo-1,4-diazepan-4-ium-1-yl)acetamide (PubChem CID 11395046) has the molecular formula C18H28N3O2S+ and a molecular weight of 350.51 g/mol. Its IUPAC name is N-(2-benzylsulfanylethyl)-2-(4,4-dimethyl-2-oxo-1,4-diazepan-4-ium-1-yl)acetamide.
| Compound Name | N-(2-benzylsulfanylethyl)-2-(4,4-dimethyl-2-oxo-1,4-diazepan-4-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 11395046 |
| Molecular Formula | C18H28N3O2S+ |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | N-(2-benzylsulfanylethyl)-2-(4,4-dimethyl-2-oxo-1,4-diazepan-4-ium-1-yl)acetamide |
| SMILES | C[N+]1(C)CCCN(CC(=O)NCCSCc2ccccc2)C(=O)C1 |
| InChI | InChI=1S/C18H27N3O2S/c1-21(2)11-6-10-20(18(23)14-21)13-17(22)19-9-12-24-15-16-7-4-3-5-8-16/h3-5,7-8H,6,9-15H2,1-2H3/p+1 |
| InChIKey | KVDKVDQPBVFWEQ-UHFFFAOYSA-O |
| XLogP | 1.34 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|