C20H23NOS — CID 32965914
N-(2-benzylsulfanylethyl)-2-(2,3-dihydro-1H-inden-5-yl)acetamide (PubChem CID 32965914) has the molecular formula C20H23NOS and a molecular weight of 325.48 g/mol. Its IUPAC name is N-(2-benzylsulfanylethyl)-2-(2,3-dihydro-1H-inden-5-yl)acetamide.
| Compound Name | N-(2-benzylsulfanylethyl)-2-(2,3-dihydro-1H-inden-5-yl)acetamide |
|---|---|
| PubChem CID | 32965914 |
| Molecular Formula | C20H23NOS |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | N-(2-benzylsulfanylethyl)-2-(2,3-dihydro-1H-inden-5-yl)acetamide |
| SMILES | O=C(Cc1ccc2c(c1)CCC2)NCCSCc1ccccc1 |
| InChI | InChI=1S/C20H23NOS/c22-20(14-17-9-10-18-7-4-8-19(18)13-17)21-11-12-23-15-16-5-2-1-3-6-16/h1-3,5-6,9-10,13H,4,7-8,11-12,14-15H2,(H,21,22) |
| InChIKey | JWMVQNMGQBYVMB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|