C20H27Cl2N3O — CID 119851308
2-amino-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-2-phenylacetamide;dihydrochloride (PubChem CID 119851308) has the molecular formula C20H27Cl2N3O and a molecular weight of 396.36 g/mol. Its IUPAC name is 2-amino-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-2-phenylacetamide;dihydrochloride.
| Compound Name | 2-amino-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-2-phenylacetamide;dihydrochloride |
|---|---|
| PubChem CID | 119851308 |
| Molecular Formula | C20H27Cl2N3O |
| Molecular Weight | 396.36 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 2-amino-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-2-phenylacetamide;dihydrochloride |
| SMILES | Cl.Cl.NC(C(=O)NCCCN1CCc2ccccc2C1)c1ccccc1 |
| InChI | InChI=1S/C20H25N3O.2ClH/c21-19(17-8-2-1-3-9-17)20(24)22-12-6-13-23-14-11-16-7-4-5-10-18(16)15-23;;/h1-5,7-10,19H,6,11-15,21H2,(H,22,24);2*1H |
| InChIKey | AFWBCJSYIQSHGC-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|