C11H22N4O2S — CID 106326717
3-amino-3-hydroxyimino-2,2-dimethyl-N-(2-thiomorpholin-4-ylethyl)propanamide (PubChem CID 106326717) has the molecular formula C11H22N4O2S and a molecular weight of 274.39 g/mol. Its IUPAC name is 3-amino-3-hydroxyimino-2,2-dimethyl-N-(2-thiomorpholin-4-ylethyl)propanamide.
| Compound Name | 3-amino-3-hydroxyimino-2,2-dimethyl-N-(2-thiomorpholin-4-ylethyl)propanamide |
|---|---|
| PubChem CID | 106326717 |
| Molecular Formula | C11H22N4O2S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 3-amino-3-hydroxyimino-2,2-dimethyl-N-(2-thiomorpholin-4-ylethyl)propanamide |
| SMILES | CC(C)(C(=O)NCCN1CCSCC1)C(N)=NO |
| InChI | InChI=1S/C11H22N4O2S/c1-11(2,9(12)14-17)10(16)13-3-4-15-5-7-18-8-6-15/h17H,3-8H2,1-2H3,(H2,12,14)(H,13,16) |
| InChIKey | VFDFZTJKZZSKTM-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|