C11H22N4O2 — CID 117235873
1-(azetidin-3-ylmethyl)-3-(2-morpholin-4-ylethyl)urea (PubChem CID 117235873) has the molecular formula C11H22N4O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is 1-(azetidin-3-ylmethyl)-3-(2-morpholin-4-ylethyl)urea.
| Compound Name | 1-(azetidin-3-ylmethyl)-3-(2-morpholin-4-ylethyl)urea |
|---|---|
| PubChem CID | 117235873 |
| Molecular Formula | C11H22N4O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | 1-(azetidin-3-ylmethyl)-3-(2-morpholin-4-ylethyl)urea |
| SMILES | O=C(NCCN1CCOCC1)NCC1CNC1 |
| InChI | InChI=1S/C11H22N4O2/c16-11(14-9-10-7-12-8-10)13-1-2-15-3-5-17-6-4-15/h10,12H,1-9H2,(H2,13,14,16) |
| InChIKey | XGFBKJDTIVNLHZ-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |