C11H24N2O5S — CID 170359456
2-[2-(dimethylamino)ethoxy]-N-[2-(2-methylsulfonylethoxy)ethyl]acetamide (PubChem CID 170359456) has the molecular formula C11H24N2O5S and a molecular weight of 296.39 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethoxy]-N-[2-(2-methylsulfonylethoxy)ethyl]acetamide.
| Compound Name | 2-[2-(dimethylamino)ethoxy]-N-[2-(2-methylsulfonylethoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 170359456 |
| Molecular Formula | C11H24N2O5S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 2-[2-(dimethylamino)ethoxy]-N-[2-(2-methylsulfonylethoxy)ethyl]acetamide |
| SMILES | CN(C)CCOCC(=O)NCCOCCS(C)(=O)=O |
| InChI | InChI=1S/C11H24N2O5S/c1-13(2)5-7-18-10-11(14)12-4-6-17-8-9-19(3,15)16/h4-10H2,1-3H3,(H,12,14) |
| InChIKey | SNIKVFFTYBJXGO-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|