C19H39N3O8 — CID 59101699
2-[2-[2-[2,2-bis(ethoxymethyl)hydrazinyl]-2-oxoethoxy]ethoxy]-N-(1,3-diethoxypropan-2-yl)acetamide (PubChem CID 59101699) has the molecular formula C19H39N3O8 and a molecular weight of 437.53 g/mol. Its IUPAC name is 2-[2-[2-[2,2-bis(ethoxymethyl)hydrazinyl]-2-oxoethoxy]ethoxy]-N-(1,3-diethoxypropan-2-yl)acetamide.
| Compound Name | 2-[2-[2-[2,2-bis(ethoxymethyl)hydrazinyl]-2-oxoethoxy]ethoxy]-N-(1,3-diethoxypropan-2-yl)acetamide |
|---|---|
| PubChem CID | 59101699 |
| Molecular Formula | C19H39N3O8 |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | 2-[2-[2-[2,2-bis(ethoxymethyl)hydrazinyl]-2-oxoethoxy]ethoxy]-N-(1,3-diethoxypropan-2-yl)acetamide |
| SMILES | CCOCC(COCC)NC(=O)COCCOCC(=O)NN(COCC)COCC |
| InChI | InChI=1S/C19H39N3O8/c1-5-25-11-17(12-26-6-2)20-18(23)13-29-9-10-30-14-19(24)21-22(15-27-7-3)16-28-8-4/h17H,5-16H2,1-4H3,(H,20,23)(H,21,24) |
| InChIKey | PDBSTKOJKSEGHM-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 116.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|