C7H15NO4 — CID 65314889
N-(1,3-dihydroxypropan-2-yl)-2-ethoxyacetamide (PubChem CID 65314889) has the molecular formula C7H15NO4 and a molecular weight of 177.20 g/mol. Its IUPAC name is N-(1,3-dihydroxypropan-2-yl)-2-ethoxyacetamide.
| Compound Name | N-(1,3-dihydroxypropan-2-yl)-2-ethoxyacetamide |
|---|---|
| PubChem CID | 65314889 |
| Molecular Formula | C7H15NO4 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | N-(1,3-dihydroxypropan-2-yl)-2-ethoxyacetamide |
| SMILES | CCOCC(=O)NC(CO)CO |
| InChI | InChI=1S/C7H15NO4/c1-2-12-5-7(11)8-6(3-9)4-10/h6,9-10H,2-5H2,1H3,(H,8,11) |
| InChIKey | VFENLPMZRKXRQB-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |