C20H40N2O8 — CID 21337734
N-(1,3-diethoxypropan-2-yl)-2-[2-[2-(1,3-diethoxypropan-2-ylamino)-2-oxoethoxy]ethoxy]acetamide (PubChem CID 21337734) has the molecular formula C20H40N2O8 and a molecular weight of 436.55 g/mol. Its IUPAC name is N-(1,3-diethoxypropan-2-yl)-2-[2-[2-(1,3-diethoxypropan-2-ylamino)-2-oxoethoxy]ethoxy]acetamide.
| Compound Name | N-(1,3-diethoxypropan-2-yl)-2-[2-[2-(1,3-diethoxypropan-2-ylamino)-2-oxoethoxy]ethoxy]acetamide |
|---|---|
| PubChem CID | 21337734 |
| Molecular Formula | C20H40N2O8 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | N-(1,3-diethoxypropan-2-yl)-2-[2-[2-(1,3-diethoxypropan-2-ylamino)-2-oxoethoxy]ethoxy]acetamide |
| SMILES | CCOCC(COCC)NC(=O)COCCOCC(=O)NC(COCC)COCC |
| InChI | InChI=1S/C20H40N2O8/c1-5-25-11-17(12-26-6-2)21-19(23)15-29-9-10-30-16-20(24)22-18(13-27-7-3)14-28-8-4/h17-18H,5-16H2,1-4H3,(H,21,23)(H,22,24) |
| InChIKey | DLXQVIZCMZURJZ-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 113.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|