C18H37NO4 — CID 171771197
N-[1,3-bis(2-methylpropoxy)propan-2-yl]-2-(3-methylbutoxy)acetamide (PubChem CID 171771197) has the molecular formula C18H37NO4 and a molecular weight of 331.50 g/mol. Its IUPAC name is N-[1,3-bis(2-methylpropoxy)propan-2-yl]-2-(3-methylbutoxy)acetamide.
| Compound Name | N-[1,3-bis(2-methylpropoxy)propan-2-yl]-2-(3-methylbutoxy)acetamide |
|---|---|
| PubChem CID | 171771197 |
| Molecular Formula | C18H37NO4 |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.27 |
| IUPAC Name | N-[1,3-bis(2-methylpropoxy)propan-2-yl]-2-(3-methylbutoxy)acetamide |
| SMILES | CC(C)CCOCC(=O)NC(COCC(C)C)COCC(C)C |
| InChI | InChI=1S/C18H37NO4/c1-14(2)7-8-21-13-18(20)19-17(11-22-9-15(3)4)12-23-10-16(5)6/h14-17H,7-13H2,1-6H3,(H,19,20) |
| InChIKey | RNJJOTKMRUANHK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|