About 2-amino-N-ethylacetamide;hydroxy-methyl-oxophosphanium
2-amino-N-ethylacetamide;hydroxy-methyl-oxophosphanium (PubChem CID 88711481) has the molecular formula C5H14N2O3P+
and a molecular weight of 181.15 g/mol. Its IUPAC name is 2-amino-N-ethylacetamide;hydroxy-methyl-oxophosphanium.
Molecular Properties
| Compound Name | 2-amino-N-ethylacetamide;hydroxy-methyl-oxophosphanium |
| PubChem CID | 88711481 |
| Molecular Formula | C5H14N2O3P+ |
| Molecular Weight | 181.15 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 2-amino-N-ethylacetamide;hydroxy-methyl-oxophosphanium |
| SMILES | CCNC(=O)CN.C[P+](=O)O |
| InChI | InChI=1S/C4H10N2O.CH3O2P/c1-2-6-4(7)3-5;1-4(2)3/h2-3,5H2,1H3,(H,6,7);1H3/p+1 |
| InChIKey | WSVCDTRFXRYYSC-UHFFFAOYSA-O |
| XLogP | -0.57 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.15 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-N-ethylacetamide;hydroxy-methyl-oxophosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-ethylacetamide;hydroxy-methyl-oxophosphanium?
The IUPAC name of 2-amino-N-ethylacetamide;hydroxy-methyl-oxophosphanium (CID 88711481) is 2-amino-N-ethylacetamide;hydroxy-methyl-oxophosphanium.
What is the SMILES notation for 2-amino-N-ethylacetamide;hydroxy-methyl-oxophosphanium?
The canonical SMILES for 2-amino-N-ethylacetamide;hydroxy-methyl-oxophosphanium is CCNC(=O)CN.C[P+](=O)O.
What is the InChIKey of 2-amino-N-ethylacetamide;hydroxy-methyl-oxophosphanium?
The InChIKey is WSVCDTRFXRYYSC-UHFFFAOYSA-O. The full InChI is InChI=1S/C4H10N2O.CH3O2P/c1-2-6-4(7)3-5;1-4(2)3/h2-3,5H2,1H3,(H,6,7);1H3/p+1.
What are the key properties of 2-amino-N-ethylacetamide;hydroxy-methyl-oxophosphanium?
2-amino-N-ethylacetamide;hydroxy-methyl-oxophosphanium has a molecular weight of 181.15 g/mol, XLogP of -0.57, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-ethylacetamide;hydroxy-methyl-oxophosphanium is sourced from PubChem (CID 88711481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).