About ethenyl 6-hydroxyhexanoate
ethenyl 6-hydroxyhexanoate (PubChem CID 88593109) has the molecular formula C8H14O3
and a molecular weight of 158.20 g/mol. Its IUPAC name is ethenyl 6-hydroxyhexanoate.
Molecular Properties
| Compound Name | ethenyl 6-hydroxyhexanoate |
| PubChem CID | 88593109 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | ethenyl 6-hydroxyhexanoate |
| SMILES | C=COC(=O)CCCCCO |
| InChI | InChI=1S/C8H14O3/c1-2-11-8(10)6-4-3-5-7-9/h2,9H,1,3-7H2 |
| InChIKey | JMGRVDHFLAUVMY-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethenyl 6-hydroxyhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl 6-hydroxyhexanoate?
The IUPAC name of ethenyl 6-hydroxyhexanoate (CID 88593109) is ethenyl 6-hydroxyhexanoate.
What is the SMILES notation for ethenyl 6-hydroxyhexanoate?
The canonical SMILES for ethenyl 6-hydroxyhexanoate is C=COC(=O)CCCCCO.
What is the InChIKey of ethenyl 6-hydroxyhexanoate?
The InChIKey is JMGRVDHFLAUVMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O3/c1-2-11-8(10)6-4-3-5-7-9/h2,9H,1,3-7H2.
What are the key properties of ethenyl 6-hydroxyhexanoate?
ethenyl 6-hydroxyhexanoate has a molecular weight of 158.20 g/mol, XLogP of 1.23, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl 6-hydroxyhexanoate is sourced from PubChem (CID 88593109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).