About (2S)-2-aminopropanoic acid;sulfuric acid
(2S)-2-aminopropanoic acid;sulfuric acid (PubChem CID 56932726) has the molecular formula C3H9NO6S
and a molecular weight of 187.17 g/mol. Its IUPAC name is (2S)-2-aminopropanoic acid;sulfuric acid.
Molecular Properties
| Compound Name | (2S)-2-aminopropanoic acid;sulfuric acid |
| PubChem CID | 56932726 |
| Molecular Formula | C3H9NO6S |
| Molecular Weight | 187.17 g/mol |
| Exact Mass | 187.02 |
| IUPAC Name | (2S)-2-aminopropanoic acid;sulfuric acid |
| SMILES | C[C@H](N)C(=O)O.O=S(=O)(O)O |
| InChI | InChI=1S/C3H7NO2.H2O4S/c1-2(4)3(5)6;1-5(2,3)4/h2H,4H2,1H3,(H,5,6);(H2,1,2,3,4)/t2-;/m0./s1 |
| InChIKey | RZLFKJRZFPKYKF-DKWTVANSSA-N |
| XLogP | -1.23 |
| TPSA | 137.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.17 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-aminopropanoic acid;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-aminopropanoic acid;sulfuric acid?
The IUPAC name of (2S)-2-aminopropanoic acid;sulfuric acid (CID 56932726) is (2S)-2-aminopropanoic acid;sulfuric acid.
What is the SMILES notation for (2S)-2-aminopropanoic acid;sulfuric acid?
The canonical SMILES for (2S)-2-aminopropanoic acid;sulfuric acid is C[C@H](N)C(=O)O.O=S(=O)(O)O.
What is the InChIKey of (2S)-2-aminopropanoic acid;sulfuric acid?
The InChIKey is RZLFKJRZFPKYKF-DKWTVANSSA-N. The full InChI is InChI=1S/C3H7NO2.H2O4S/c1-2(4)3(5)6;1-5(2,3)4/h2H,4H2,1H3,(H,5,6);(H2,1,2,3,4)/t2-;/m0./s1.
What are the key properties of (2S)-2-aminopropanoic acid;sulfuric acid?
(2S)-2-aminopropanoic acid;sulfuric acid has a molecular weight of 187.17 g/mol, XLogP of -1.23, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-aminopropanoic acid;sulfuric acid is sourced from PubChem (CID 56932726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).