C24H40N4O4 — CID 101191520
(2S)-6-[[3,5-bis[(dimethylamino)methyl]benzoyl]amino]-2-(2,2-dimethylpropanoylamino)hexanoic acid (PubChem CID 101191520) has the molecular formula C24H40N4O4 and a molecular weight of 448.61 g/mol. Its IUPAC name is (2S)-6-[[3,5-bis[(dimethylamino)methyl]benzoyl]amino]-2-(2,2-dimethylpropanoylamino)hexanoic acid.
| Compound Name | (2S)-6-[[3,5-bis[(dimethylamino)methyl]benzoyl]amino]-2-(2,2-dimethylpropanoylamino)hexanoic acid |
|---|---|
| PubChem CID | 101191520 |
| Molecular Formula | C24H40N4O4 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | (2S)-6-[[3,5-bis[(dimethylamino)methyl]benzoyl]amino]-2-(2,2-dimethylpropanoylamino)hexanoic acid |
| SMILES | CN(C)Cc1cc(CN(C)C)cc(C(=O)NCCCC[C@H](NC(=O)C(C)(C)C)C(=O)O)c1 |
| InChI | InChI=1S/C24H40N4O4/c1-24(2,3)23(32)26-20(22(30)31)10-8-9-11-25-21(29)19-13-17(15-27(4)5)12-18(14-19)16-28(6)7/h12-14,20H,8-11,15-16H2,1-7H3,(H,25,29)(H,26,32)(H,30,31)/t20-/m0/s1 |
| InChIKey | FPZHWXDBJXVQHU-FQEVSTJZSA-N |
| XLogP | 2.33 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|