C27H43N5O7 — CID 143937270
(2S)-5-[[(2S)-1-amino-6-[(4-aminobenzoyl)amino]-1-oxohexan-2-yl]amino]-2-[(5-hydroxy-2,2,4,4-tetramethylpentanoyl)amino]-5-oxopentanoic acid (PubChem CID 143937270) has the molecular formula C27H43N5O7 and a molecular weight of 549.67 g/mol. Its IUPAC name is (2S)-5-[[(2S)-1-amino-6-[(4-aminobenzoyl)amino]-1-oxohexan-2-yl]amino]-2-[(5-hydroxy-2,2,4,4-tetramethylpentanoyl)amino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-[[(2S)-1-amino-6-[(4-aminobenzoyl)amino]-1-oxohexan-2-yl]amino]-2-[(5-hydroxy-2,2,4,4-tetramethylpentanoyl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 143937270 |
| Molecular Formula | C27H43N5O7 |
| Molecular Weight | 549.67 g/mol |
| Exact Mass | 549.32 |
| IUPAC Name | (2S)-5-[[(2S)-1-amino-6-[(4-aminobenzoyl)amino]-1-oxohexan-2-yl]amino]-2-[(5-hydroxy-2,2,4,4-tetramethylpentanoyl)amino]-5-oxopentanoic acid |
| SMILES | CC(C)(CO)CC(C)(C)C(=O)N[C@@H](CCC(=O)N[C@@H](CCCCNC(=O)c1ccc(N)cc1)C(N)=O)C(=O)O |
| InChI | InChI=1S/C27H43N5O7/c1-26(2,16-33)15-27(3,4)25(39)32-20(24(37)38)12-13-21(34)31-19(22(29)35)7-5-6-14-30-23(36)17-8-10-18(28)11-9-17/h8-11,19-20,33H,5-7,12-16,28H2,1-4H3,(H2,29,35)(H,30,36)(H,31,34)(H,32,39)(H,37,38)/t19-,20-/m0/s1 |
| InChIKey | QKHXZPBQWZNKCN-PMACEKPBSA-N |
| XLogP | 0.92 |
| TPSA | 213.94 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.67 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|