C30H48N6O12S — CID 143937305
4-amino-N-butylbenzamide;5-[[1-[[4-[(2-amino-2-oxoethyl)amino]-1-carboxy-4-oxobutyl]amino]-1-oxo-3-sulfopropan-2-yl]amino]-2,2,4,4-tetramethyl-5-oxopentanoic acid (PubChem CID 143937305) has the molecular formula C30H48N6O12S and a molecular weight of 716.81 g/mol. Its IUPAC name is 4-amino-N-butylbenzamide;5-[[1-[[4-[(2-amino-2-oxoethyl)amino]-1-carboxy-4-oxobutyl]amino]-1-oxo-3-sulfopropan-2-yl]amino]-2,2,4,4-tetramethyl-5-oxopentanoic acid.
| Compound Name | 4-amino-N-butylbenzamide;5-[[1-[[4-[(2-amino-2-oxoethyl)amino]-1-carboxy-4-oxobutyl]amino]-1-oxo-3-sulfopropan-2-yl]amino]-2,2,4,4-tetramethyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 143937305 |
| Molecular Formula | C30H48N6O12S |
| Molecular Weight | 716.81 g/mol |
| Exact Mass | 716.31 |
| IUPAC Name | 4-amino-N-butylbenzamide;5-[[1-[[4-[(2-amino-2-oxoethyl)amino]-1-carboxy-4-oxobutyl]amino]-1-oxo-3-sulfopropan-2-yl]amino]-2,2,4,4-tetramethyl-5-oxopentanoic acid |
| SMILES | CC(C)(CC(C)(C)C(=O)NC(CS(=O)(=O)O)C(=O)NC(CCC(=O)NCC(N)=O)C(=O)O)C(=O)O.CCCCNC(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C19H32N4O11S.C11H16N2O/c1-18(2,9-19(3,4)17(30)31)16(29)23-11(8-35(32,33)34)14(26)22-10(15(27)28)5-6-13(25)21-7-12(20)24;1-2-3-8-13-11(14)9-4-6-10(12)7-5-9/h10-11H,5-9H2,1-4H3,(H2,20,24)(H,21,25)(H,22,26)(H,23,29)(H,27,28)(H,30,31)(H,32,33,34);4-7H,2-3,8,12H2,1H3,(H,13,14) |
| InChIKey | NYOULOBNAVIMSP-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 314.48 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.81 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|