C26H41N5O7S2 — CID 143937302
5-[[1-carboxy-4-oxo-4-[3-[[4-[2-(sulfanylamino)sulfanylethylamino]benzoyl]amino]propylamino]butyl]amino]-2,2,4,4-tetramethyl-5-oxopentanoic acid (PubChem CID 143937302) has the molecular formula C26H41N5O7S2 and a molecular weight of 599.78 g/mol. Its IUPAC name is 5-[[1-carboxy-4-oxo-4-[3-[[4-[2-(sulfanylamino)sulfanylethylamino]benzoyl]amino]propylamino]butyl]amino]-2,2,4,4-tetramethyl-5-oxopentanoic acid.
| Compound Name | 5-[[1-carboxy-4-oxo-4-[3-[[4-[2-(sulfanylamino)sulfanylethylamino]benzoyl]amino]propylamino]butyl]amino]-2,2,4,4-tetramethyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 143937302 |
| Molecular Formula | C26H41N5O7S2 |
| Molecular Weight | 599.78 g/mol |
| Exact Mass | 599.24 |
| IUPAC Name | 5-[[1-carboxy-4-oxo-4-[3-[[4-[2-(sulfanylamino)sulfanylethylamino]benzoyl]amino]propylamino]butyl]amino]-2,2,4,4-tetramethyl-5-oxopentanoic acid |
| SMILES | CC(C)(CC(C)(C)C(=O)NC(CCC(=O)NCCCNC(=O)c1ccc(NCCSNS)cc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C26H41N5O7S2/c1-25(2,16-26(3,4)24(37)38)23(36)30-19(22(34)35)10-11-20(32)28-12-5-13-29-21(33)17-6-8-18(9-7-17)27-14-15-40-31-39/h6-9,19,27,31,39H,5,10-16H2,1-4H3,(H,28,32)(H,29,33)(H,30,36)(H,34,35)(H,37,38) |
| InChIKey | HCGNVHFUUINVHH-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 185.96 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.78 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|