C22H21Cl2F3N2O5 — CID 86598318
methyl (2S)-3-[4-(3-benzamidopropoxy)-3,5-dichlorophenyl]-2-[(2,2,2-trifluoroacetyl)amino]propanoate (PubChem CID 86598318) has the molecular formula C22H21Cl2F3N2O5 and a molecular weight of 521.32 g/mol. Its IUPAC name is methyl (2S)-3-[4-(3-benzamidopropoxy)-3,5-dichlorophenyl]-2-[(2,2,2-trifluoroacetyl)amino]propanoate.
| Compound Name | methyl (2S)-3-[4-(3-benzamidopropoxy)-3,5-dichlorophenyl]-2-[(2,2,2-trifluoroacetyl)amino]propanoate |
|---|---|
| PubChem CID | 86598318 |
| Molecular Formula | C22H21Cl2F3N2O5 |
| Molecular Weight | 521.32 g/mol |
| Exact Mass | 520.08 |
| IUPAC Name | methyl (2S)-3-[4-(3-benzamidopropoxy)-3,5-dichlorophenyl]-2-[(2,2,2-trifluoroacetyl)amino]propanoate |
| SMILES | COC(=O)[C@H](Cc1cc(Cl)c(OCCCNC(=O)c2ccccc2)c(Cl)c1)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C22H21Cl2F3N2O5/c1-33-20(31)17(29-21(32)22(25,26)27)12-13-10-15(23)18(16(24)11-13)34-9-5-8-28-19(30)14-6-3-2-4-7-14/h2-4,6-7,10-11,17H,5,8-9,12H2,1H3,(H,28,30)(H,29,32)/t17-/m0/s1 |
| InChIKey | ZQBGLHWBGCHKTR-KRWDZBQOSA-N |
| XLogP | 3.95 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.32 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|