C17H23N3O7 — CID 122617207
2-[[2-[4-(4-aminophenyl)butanoyl-hydroxyamino]acetyl]amino]pentanedioic acid (PubChem CID 122617207) has the molecular formula C17H23N3O7 and a molecular weight of 381.39 g/mol. Its IUPAC name is 2-[[2-[4-(4-aminophenyl)butanoyl-hydroxyamino]acetyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[4-(4-aminophenyl)butanoyl-hydroxyamino]acetyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 122617207 |
| Molecular Formula | C17H23N3O7 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 2-[[2-[4-(4-aminophenyl)butanoyl-hydroxyamino]acetyl]amino]pentanedioic acid |
| SMILES | Nc1ccc(CCCC(=O)N(O)CC(=O)NC(CCC(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C17H23N3O7/c18-12-6-4-11(5-7-12)2-1-3-15(22)20(27)10-14(21)19-13(17(25)26)8-9-16(23)24/h4-7,13,27H,1-3,8-10,18H2,(H,19,21)(H,23,24)(H,25,26) |
| InChIKey | VZHBPBCRVAMELZ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 170.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|