C18H25N3O9 — CID 89418107
(2S)-2-[[2-[2-(3,4-dimethoxyphenyl)ethylcarbamoyl-hydroxyamino]acetyl]amino]pentanedioic acid (PubChem CID 89418107) has the molecular formula C18H25N3O9 and a molecular weight of 427.41 g/mol. Its IUPAC name is (2S)-2-[[2-[2-(3,4-dimethoxyphenyl)ethylcarbamoyl-hydroxyamino]acetyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[2-[2-(3,4-dimethoxyphenyl)ethylcarbamoyl-hydroxyamino]acetyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 89418107 |
| Molecular Formula | C18H25N3O9 |
| Molecular Weight | 427.41 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | (2S)-2-[[2-[2-(3,4-dimethoxyphenyl)ethylcarbamoyl-hydroxyamino]acetyl]amino]pentanedioic acid |
| SMILES | COc1ccc(CCNC(=O)N(O)CC(=O)N[C@@H](CCC(=O)O)C(=O)O)cc1OC |
| InChI | InChI=1S/C18H25N3O9/c1-29-13-5-3-11(9-14(13)30-2)7-8-19-18(27)21(28)10-15(22)20-12(17(25)26)4-6-16(23)24/h3,5,9,12,28H,4,6-8,10H2,1-2H3,(H,19,27)(H,20,22)(H,23,24)(H,25,26)/t12-/m0/s1 |
| InChIKey | CGXOLCAHRPZITR-LBPRGKRZSA-N |
| XLogP | 0.08 |
| TPSA | 174.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.41 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|