C22H37N3O4 — CID 42703578
3-[butan-2-yl(butylcarbamoyl)amino]-N-[2-(3,4-dimethoxyphenyl)ethyl]propanamide (PubChem CID 42703578) has the molecular formula C22H37N3O4 and a molecular weight of 407.56 g/mol. Its IUPAC name is 3-[butan-2-yl(butylcarbamoyl)amino]-N-[2-(3,4-dimethoxyphenyl)ethyl]propanamide.
| Compound Name | 3-[butan-2-yl(butylcarbamoyl)amino]-N-[2-(3,4-dimethoxyphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 42703578 |
| Molecular Formula | C22H37N3O4 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.28 |
| IUPAC Name | 3-[butan-2-yl(butylcarbamoyl)amino]-N-[2-(3,4-dimethoxyphenyl)ethyl]propanamide |
| SMILES | CCCCNC(=O)N(CCC(=O)NCCc1ccc(OC)c(OC)c1)C(C)CC |
| InChI | InChI=1S/C22H37N3O4/c1-6-8-13-24-22(27)25(17(3)7-2)15-12-21(26)23-14-11-18-9-10-19(28-4)20(16-18)29-5/h9-10,16-17H,6-8,11-15H2,1-5H3,(H,23,26)(H,24,27) |
| InChIKey | OAXYBVZWACKYIW-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|