C21H21FN2O7 — CID 89116293
(2S)-2-[2-[4-(4-fluorobenzoyl)oxyphenyl]ethylcarbamoylamino]pentanedioic acid (PubChem CID 89116293) has the molecular formula C21H21FN2O7 and a molecular weight of 432.40 g/mol. Its IUPAC name is (2S)-2-[2-[4-(4-fluorobenzoyl)oxyphenyl]ethylcarbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[2-[4-(4-fluorobenzoyl)oxyphenyl]ethylcarbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 89116293 |
| Molecular Formula | C21H21FN2O7 |
| Molecular Weight | 432.40 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | (2S)-2-[2-[4-(4-fluorobenzoyl)oxyphenyl]ethylcarbamoylamino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)NCCc1ccc(OC(=O)c2ccc(F)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C21H21FN2O7/c22-15-5-3-14(4-6-15)20(29)31-16-7-1-13(2-8-16)11-12-23-21(30)24-17(19(27)28)9-10-18(25)26/h1-8,17H,9-12H2,(H,25,26)(H,27,28)(H2,23,24,30)/t17-/m0/s1 |
| InChIKey | JALSTHICROVIIM-KRWDZBQOSA-N |
| XLogP | 2.20 |
| TPSA | 142.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.40 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|